Urolithin B (1139-83-9) Mugadziri fekitori

Urolithin B

November 9, 2020

Urolithin BSpecifications

Name: Urolithin B
Kemikari Zita: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139-83-9
Chemical Fomula: C13H8O3
Molecular Weight: 212.2 g / mol
Color:  White powder
InChi Kiyi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
NHASI Code: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
basa: Urolithin B inogona kuvandudza mitochondrial uye tsandanyama basa.

Urolithin B inogona kuvandudza muswe simba uye kutsungirira panguva yekukwegura.

Application: Urolithin B ndeye intestinal microbial metabolite ye ellagitannis uye inoratidza inokwanisa-anti-oxidant uye pro-oxidant activies zvinoenderana neye assay system nemamiriro ezvinhu. Urolithin B inogonawo kuratidza estrogenic uye / kana anti-estrogenic basa.
Solubility: Rinyoro nyoro muN, N-dimethylformamide uye dimethylmethylene. Sulfone, zvishoma yakanyungudika mune methanol, ethanol, uye ethyl acetate
Storage Temp: Hygroscopic, -20 ° C Freezer, Pasi mumhepo yakaoma
Mamiriro Ekutumira: Inotengeswa pasi pekushisa kwakadzika semakemikari asina ngozi. Ichi chigadzirwa chakasimba zvakakwana kwemavhiki mashomanana panguva yekutakura uye nguva inoshandiswa muDare.